C17H25ClO5 — CID 139490027
3-[[4-chloro-3-(3-methoxypropoxy)phenoxy]methyl]-4-methylpentanoic acid (PubChem CID 139490027) has the molecular formula C17H25ClO5 and a molecular weight of 344.84 g/mol. Its IUPAC name is 3-[[4-chloro-3-(3-methoxypropoxy)phenoxy]methyl]-4-methylpentanoic acid.
| Compound Name | 3-[[4-chloro-3-(3-methoxypropoxy)phenoxy]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 139490027 |
| Molecular Formula | C17H25ClO5 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 3-[[4-chloro-3-(3-methoxypropoxy)phenoxy]methyl]-4-methylpentanoic acid |
| SMILES | COCCCOc1cc(OCC(CC(=O)O)C(C)C)ccc1Cl |
| InChI | InChI=1S/C17H25ClO5/c1-12(2)13(9-17(19)20)11-23-14-5-6-15(18)16(10-14)22-8-4-7-21-3/h5-6,10,12-13H,4,7-9,11H2,1-3H3,(H,19,20) |
| InChIKey | FHAMFTCULAOKLB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|