C13H17ClO4S — CID 155339816
3-[4-chloro-3-(3-methoxypropoxy)phenyl]sulfanylpropanoic acid (PubChem CID 155339816) has the molecular formula C13H17ClO4S and a molecular weight of 304.80 g/mol. Its IUPAC name is 3-[4-chloro-3-(3-methoxypropoxy)phenyl]sulfanylpropanoic acid.
| Compound Name | 3-[4-chloro-3-(3-methoxypropoxy)phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 155339816 |
| Molecular Formula | C13H17ClO4S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-[4-chloro-3-(3-methoxypropoxy)phenyl]sulfanylpropanoic acid |
| SMILES | COCCCOc1cc(SCCC(=O)O)ccc1Cl |
| InChI | InChI=1S/C13H17ClO4S/c1-17-6-2-7-18-12-9-10(3-4-11(12)14)19-8-5-13(15)16/h3-4,9H,2,5-8H2,1H3,(H,15,16) |
| InChIKey | TYOCJXQHUJKMHQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|