C18H17Cl3O3 — CID 69049805
6-[2-chloro-4-(3,4-dichlorophenyl)phenoxy]hexanoic acid (PubChem CID 69049805) has the molecular formula C18H17Cl3O3 and a molecular weight of 387.69 g/mol. Its IUPAC name is 6-[2-chloro-4-(3,4-dichlorophenyl)phenoxy]hexanoic acid.
| Compound Name | 6-[2-chloro-4-(3,4-dichlorophenyl)phenoxy]hexanoic acid |
|---|---|
| PubChem CID | 69049805 |
| Molecular Formula | C18H17Cl3O3 |
| Molecular Weight | 387.69 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 6-[2-chloro-4-(3,4-dichlorophenyl)phenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccc(-c2ccc(Cl)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C18H17Cl3O3/c19-14-7-5-12(10-15(14)20)13-6-8-17(16(21)11-13)24-9-3-1-2-4-18(22)23/h5-8,10-11H,1-4,9H2,(H,22,23) |
| InChIKey | IBJJATLOFFUUGB-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|