C18H15Cl3O4S — CID 22172449
6-(3,7,8-trichlorophenoxathiin-2-yl)oxyhexanoic acid (PubChem CID 22172449) has the molecular formula C18H15Cl3O4S and a molecular weight of 433.74 g/mol. Its IUPAC name is 6-(3,7,8-trichlorophenoxathiin-2-yl)oxyhexanoic acid.
| Compound Name | 6-(3,7,8-trichlorophenoxathiin-2-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 22172449 |
| Molecular Formula | C18H15Cl3O4S |
| Molecular Weight | 433.74 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 6-(3,7,8-trichlorophenoxathiin-2-yl)oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOc1cc2c(cc1Cl)Oc1cc(Cl)c(Cl)cc1S2 |
| InChI | InChI=1S/C18H15Cl3O4S/c19-10-6-14-16(8-11(10)20)26-17-9-13(12(21)7-15(17)25-14)24-5-3-1-2-4-18(22)23/h6-9H,1-5H2,(H,22,23) |
| InChIKey | FNBCODGBNFRUMJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.74 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|