C27H28Cl4O5 — CID 139978732
6-oxo-6-[8-(2,3,6,7-tetrachloroxanthen-9-ylidene)octoxy]hexanoic acid (PubChem CID 139978732) has the molecular formula C27H28Cl4O5 and a molecular weight of 574.33 g/mol. Its IUPAC name is 6-oxo-6-[8-(2,3,6,7-tetrachloroxanthen-9-ylidene)octoxy]hexanoic acid.
| Compound Name | 6-oxo-6-[8-(2,3,6,7-tetrachloroxanthen-9-ylidene)octoxy]hexanoic acid |
|---|---|
| PubChem CID | 139978732 |
| Molecular Formula | C27H28Cl4O5 |
| Molecular Weight | 574.33 g/mol |
| Exact Mass | 572.07 |
| IUPAC Name | 6-oxo-6-[8-(2,3,6,7-tetrachloroxanthen-9-ylidene)octoxy]hexanoic acid |
| SMILES | O=C(O)CCCCC(=O)OCCCCCCCC=C1c2cc(Cl)c(Cl)cc2Oc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C27H28Cl4O5/c28-20-13-18-17(19-14-21(29)23(31)16-25(19)36-24(18)15-22(20)30)9-5-3-1-2-4-8-12-35-27(34)11-7-6-10-26(32)33/h9,13-16H,1-8,10-12H2,(H,32,33) |
| InChIKey | CFEIMMKNMFURJG-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.33 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|