C18H14Cl4O4S — CID 22172452
6-(3,6,7,8-tetrachlorophenoxathiin-2-yl)oxyhexanoic acid (PubChem CID 22172452) has the molecular formula C18H14Cl4O4S and a molecular weight of 468.19 g/mol. Its IUPAC name is 6-(3,6,7,8-tetrachlorophenoxathiin-2-yl)oxyhexanoic acid.
| Compound Name | 6-(3,6,7,8-tetrachlorophenoxathiin-2-yl)oxyhexanoic acid |
|---|---|
| PubChem CID | 22172452 |
| Molecular Formula | C18H14Cl4O4S |
| Molecular Weight | 468.19 g/mol |
| Exact Mass | 465.94 |
| IUPAC Name | 6-(3,6,7,8-tetrachlorophenoxathiin-2-yl)oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOc1cc2c(cc1Cl)Oc1c(cc(Cl)c(Cl)c1Cl)S2 |
| InChI | InChI=1S/C18H14Cl4O4S/c19-9-6-12-13(8-11(9)25-5-3-1-2-4-15(23)24)27-14-7-10(20)16(21)17(22)18(14)26-12/h6-8H,1-5H2,(H,23,24) |
| InChIKey | SDLMJRROGNODMC-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.19 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|