C21H33ClO4S — CID 155339755
2-ethylhexyl 3-[4-chloro-3-(3-methoxypropoxy)phenyl]sulfanylpropanoate (PubChem CID 155339755) has the molecular formula C21H33ClO4S and a molecular weight of 417.01 g/mol. Its IUPAC name is 2-ethylhexyl 3-[4-chloro-3-(3-methoxypropoxy)phenyl]sulfanylpropanoate.
| Compound Name | 2-ethylhexyl 3-[4-chloro-3-(3-methoxypropoxy)phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 155339755 |
| Molecular Formula | C21H33ClO4S |
| Molecular Weight | 417.01 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-ethylhexyl 3-[4-chloro-3-(3-methoxypropoxy)phenyl]sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1ccc(Cl)c(OCCCOC)c1 |
| InChI | InChI=1S/C21H33ClO4S/c1-4-6-8-17(5-2)16-26-21(23)11-14-27-18-9-10-19(22)20(15-18)25-13-7-12-24-3/h9-10,15,17H,4-8,11-14,16H2,1-3H3 |
| InChIKey | WRSNSMWHQOHBJO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.01 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|