C19H29ClN2O2S — CID 150312948
2-ethylhexyl 3-[[2-(azetidin-1-yl)-3-chloro-4-pyridinyl]sulfanyl]propanoate (PubChem CID 150312948) has the molecular formula C19H29ClN2O2S and a molecular weight of 384.97 g/mol. Its IUPAC name is 2-ethylhexyl 3-[[2-(azetidin-1-yl)-3-chloro-4-pyridinyl]sulfanyl]propanoate.
| Compound Name | 2-ethylhexyl 3-[[2-(azetidin-1-yl)-3-chloro-4-pyridinyl]sulfanyl]propanoate |
|---|---|
| PubChem CID | 150312948 |
| Molecular Formula | C19H29ClN2O2S |
| Molecular Weight | 384.97 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-ethylhexyl 3-[[2-(azetidin-1-yl)-3-chloro-4-pyridinyl]sulfanyl]propanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1ccnc(N2CCC2)c1Cl |
| InChI | InChI=1S/C19H29ClN2O2S/c1-3-5-7-15(4-2)14-24-17(23)9-13-25-16-8-10-21-19(18(16)20)22-11-6-12-22/h8,10,15H,3-7,9,11-14H2,1-2H3 |
| InChIKey | GLZXTFMSIHDVFW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.97 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |