C23H29Br2Cl2IN2O2S — CID 161488423
4-bromo-3-chloro-2-iodoaniline;2-ethylhexyl 3-(6-amino-3-bromo-2-chlorophenyl)sulfanylpropanoate (PubChem CID 161488423) has the molecular formula C23H29Br2Cl2IN2O2S and a molecular weight of 755.18 g/mol. Its IUPAC name is 4-bromo-3-chloro-2-iodoaniline;2-ethylhexyl 3-(6-amino-3-bromo-2-chlorophenyl)sulfanylpropanoate.
| Compound Name | 4-bromo-3-chloro-2-iodoaniline;2-ethylhexyl 3-(6-amino-3-bromo-2-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 161488423 |
| Molecular Formula | C23H29Br2Cl2IN2O2S |
| Molecular Weight | 755.18 g/mol |
| Exact Mass | 751.87 |
| IUPAC Name | 4-bromo-3-chloro-2-iodoaniline;2-ethylhexyl 3-(6-amino-3-bromo-2-chlorophenyl)sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1c(N)ccc(Br)c1Cl.Nc1ccc(Br)c(Cl)c1I |
| InChI | InChI=1S/C17H25BrClNO2S.C6H4BrClIN/c1-3-5-6-12(4-2)11-22-15(21)9-10-23-17-14(20)8-7-13(18)16(17)19;7-3-1-2-4(10)6(9)5(3)8/h7-8,12H,3-6,9-11,20H2,1-2H3;1-2H,10H2 |
| InChIKey | WFGYHLHBELBYLK-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.18 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|