C14H24N2O2S — CID 168951446
2-ethylhexyl 3-(1H-pyrazol-4-ylsulfanyl)propanoate (PubChem CID 168951446) has the molecular formula C14H24N2O2S and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-ethylhexyl 3-(1H-pyrazol-4-ylsulfanyl)propanoate.
| Compound Name | 2-ethylhexyl 3-(1H-pyrazol-4-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 168951446 |
| Molecular Formula | C14H24N2O2S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-ethylhexyl 3-(1H-pyrazol-4-ylsulfanyl)propanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1cn[nH]c1 |
| InChI | InChI=1S/C14H24N2O2S/c1-3-5-6-12(4-2)11-18-14(17)7-8-19-13-9-15-16-10-13/h9-10,12H,3-8,11H2,1-2H3,(H,15,16) |
| InChIKey | DLEBFRASJTWKER-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |