C19H28Cl2N6O2S2 — CID 163539922
3-amino-5-chloro-1H-pyrazine-2-thione;2-ethylhexyl 3-(3-amino-5-chloropyrazin-2-yl)sulfanylpropanoate (PubChem CID 163539922) has the molecular formula C19H28Cl2N6O2S2 and a molecular weight of 507.51 g/mol. Its IUPAC name is 3-amino-5-chloro-1H-pyrazine-2-thione;2-ethylhexyl 3-(3-amino-5-chloropyrazin-2-yl)sulfanylpropanoate.
| Compound Name | 3-amino-5-chloro-1H-pyrazine-2-thione;2-ethylhexyl 3-(3-amino-5-chloropyrazin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 163539922 |
| Molecular Formula | C19H28Cl2N6O2S2 |
| Molecular Weight | 507.51 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 3-amino-5-chloro-1H-pyrazine-2-thione;2-ethylhexyl 3-(3-amino-5-chloropyrazin-2-yl)sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1ncc(Cl)nc1N.Nc1nc(Cl)c[nH]c1=S |
| InChI | InChI=1S/C15H24ClN3O2S.C4H4ClN3S/c1-3-5-6-11(4-2)10-21-13(20)7-8-22-15-14(17)19-12(16)9-18-15;5-2-1-7-4(9)3(6)8-2/h9,11H,3-8,10H2,1-2H3,(H2,17,19);1H,(H2,6,8)(H,7,9) |
| InChIKey | FAFROWYUMUGRNK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|