C19H25BrO3S — CID 59580990
2-ethylhexyl 3-[(7-bromo-1-benzofuran-5-yl)sulfanyl]propanoate (PubChem CID 59580990) has the molecular formula C19H25BrO3S and a molecular weight of 413.38 g/mol. Its IUPAC name is 2-ethylhexyl 3-[(7-bromo-1-benzofuran-5-yl)sulfanyl]propanoate.
| Compound Name | 2-ethylhexyl 3-[(7-bromo-1-benzofuran-5-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 59580990 |
| Molecular Formula | C19H25BrO3S |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-ethylhexyl 3-[(7-bromo-1-benzofuran-5-yl)sulfanyl]propanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1cc(Br)c2occc2c1 |
| InChI | InChI=1S/C19H25BrO3S/c1-3-5-6-14(4-2)13-23-18(21)8-10-24-16-11-15-7-9-22-19(15)17(20)12-16/h7,9,11-12,14H,3-6,8,10,13H2,1-2H3 |
| InChIKey | SKMLTEPASWWFTG-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |