C11H9BrO3S — CID 91597953
3-[(7-bromo-1-benzofuran-5-yl)sulfanyl]propanoic acid (PubChem CID 91597953) has the molecular formula C11H9BrO3S and a molecular weight of 301.16 g/mol. Its IUPAC name is 3-[(7-bromo-1-benzofuran-5-yl)sulfanyl]propanoic acid.
| Compound Name | 3-[(7-bromo-1-benzofuran-5-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 91597953 |
| Molecular Formula | C11H9BrO3S |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 299.95 |
| IUPAC Name | 3-[(7-bromo-1-benzofuran-5-yl)sulfanyl]propanoic acid |
| SMILES | O=C(O)CCSc1cc(Br)c2occc2c1 |
| InChI | InChI=1S/C11H9BrO3S/c12-9-6-8(16-4-2-10(13)14)5-7-1-3-15-11(7)9/h1,3,5-6H,2,4H2,(H,13,14) |
| InChIKey | XVVJBPAREIOSNX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |