C21H30N2O2S2 — CID 157250152
2-ethylhexyl 3-pyridin-3-ylsulfanylpropanoate;pyridine-3-thiol (PubChem CID 157250152) has the molecular formula C21H30N2O2S2 and a molecular weight of 406.62 g/mol. Its IUPAC name is 2-ethylhexyl 3-pyridin-3-ylsulfanylpropanoate;pyridine-3-thiol.
| Compound Name | 2-ethylhexyl 3-pyridin-3-ylsulfanylpropanoate;pyridine-3-thiol |
|---|---|
| PubChem CID | 157250152 |
| Molecular Formula | C21H30N2O2S2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-ethylhexyl 3-pyridin-3-ylsulfanylpropanoate;pyridine-3-thiol |
| SMILES | CCCCC(CC)COC(=O)CCSc1cccnc1.Sc1cccnc1 |
| InChI | InChI=1S/C16H25NO2S.C5H5NS/c1-3-5-7-14(4-2)13-19-16(18)9-11-20-15-8-6-10-17-12-15;7-5-2-1-3-6-4-5/h6,8,10,12,14H,3-5,7,9,11,13H2,1-2H3;1-4,7H |
| InChIKey | AWFZMBMWDIKHHJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|