C23H34N2O3S — CID 138618914
2-ethylhexyl 3-[3-(1-ethylpyrazol-4-yl)-5-methoxyphenyl]sulfanylpropanoate (PubChem CID 138618914) has the molecular formula C23H34N2O3S and a molecular weight of 418.60 g/mol. Its IUPAC name is 2-ethylhexyl 3-[3-(1-ethylpyrazol-4-yl)-5-methoxyphenyl]sulfanylpropanoate.
| Compound Name | 2-ethylhexyl 3-[3-(1-ethylpyrazol-4-yl)-5-methoxyphenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 138618914 |
| Molecular Formula | C23H34N2O3S |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 2-ethylhexyl 3-[3-(1-ethylpyrazol-4-yl)-5-methoxyphenyl]sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1cc(OC)cc(-c2cnn(CC)c2)c1 |
| InChI | InChI=1S/C23H34N2O3S/c1-5-8-9-18(6-2)17-28-23(26)10-11-29-22-13-19(12-21(14-22)27-4)20-15-24-25(7-3)16-20/h12-16,18H,5-11,17H2,1-4H3 |
| InChIKey | LLOZGYUEQNFDJQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |