C19H27NO6S — CID 67015876
methyl 3-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanyl-4-nitrobenzoate (PubChem CID 67015876) has the molecular formula C19H27NO6S and a molecular weight of 397.49 g/mol. Its IUPAC name is methyl 3-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanyl-4-nitrobenzoate.
| Compound Name | methyl 3-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 67015876 |
| Molecular Formula | C19H27NO6S |
| Molecular Weight | 397.49 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | methyl 3-[3-(2-ethylhexoxy)-3-oxopropyl]sulfanyl-4-nitrobenzoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1cc(C(=O)OC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H27NO6S/c1-4-6-7-14(5-2)13-26-18(21)10-11-27-17-12-15(19(22)25-3)8-9-16(17)20(23)24/h8-9,12,14H,4-7,10-11,13H2,1-3H3 |
| InChIKey | ILWGYGIRATXEOX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|