About potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate
potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate (PubChem CID 158073954) has the molecular formula C14H20KNO6S
and a molecular weight of 369.48 g/mol. Its IUPAC name is potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate.
Molecular Properties
| Compound Name | potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate |
| PubChem CID | 158073954 |
| Molecular Formula | C14H20KNO6S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate |
| SMILES | CCCC[O-].COC(=O)c1ccc(SCCO)c([N+](=O)[O-])c1.[K+] |
| InChI | InChI=1S/C10H11NO5S.C4H9O.K/c1-16-10(13)7-2-3-9(17-5-4-12)8(6-7)11(14)15;1-2-3-4-5;/h2-3,6,12H,4-5H2,1H3;2-4H2,1H3;/q;-1;+1 |
| InChIKey | DEONYYOAVKSOLW-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate?
The IUPAC name of potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate (CID 158073954) is potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate.
What is the SMILES notation for potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate?
The canonical SMILES for potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate is CCCC[O-].COC(=O)c1ccc(SCCO)c([N+](=O)[O-])c1.[K+].
What is the InChIKey of potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate?
The InChIKey is DEONYYOAVKSOLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5S.C4H9O.K/c1-16-10(13)7-2-3-9(17-5-4-12)8(6-7)11(14)15;1-2-3-4-5;/h2-3,6,12H,4-5H2,1H3;2-4H2,1H3;/q;-1;+1.
What are the key properties of potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate?
potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate has a molecular weight of 369.48 g/mol, XLogP of -1.38, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;butan-1-olate;methyl 4-(2-hydroxyethylsulfanyl)-3-nitrobenzoate is sourced from PubChem (CID 158073954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).