C24H32O2S2 — CID 130345015
2-ethylhexyl 3-(3-methylsulfanyl-4-phenylphenyl)sulfanylpropanoate (PubChem CID 130345015) has the molecular formula C24H32O2S2 and a molecular weight of 416.65 g/mol. Its IUPAC name is 2-ethylhexyl 3-(3-methylsulfanyl-4-phenylphenyl)sulfanylpropanoate.
| Compound Name | 2-ethylhexyl 3-(3-methylsulfanyl-4-phenylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 130345015 |
| Molecular Formula | C24H32O2S2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-ethylhexyl 3-(3-methylsulfanyl-4-phenylphenyl)sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1ccc(-c2ccccc2)c(SC)c1 |
| InChI | InChI=1S/C24H32O2S2/c1-4-6-10-19(5-2)18-26-24(25)15-16-28-21-13-14-22(23(17-21)27-3)20-11-8-7-9-12-20/h7-9,11-14,17,19H,4-6,10,15-16,18H2,1-3H3 |
| InChIKey | OHFUGKWHLMKBLK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |