C19H29IO2S2 — CID 130358082
2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate (PubChem CID 130358082) has the molecular formula C19H29IO2S2 and a molecular weight of 480.48 g/mol. Its IUPAC name is 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate.
| Compound Name | 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 130358082 |
| Molecular Formula | C19H29IO2S2 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate |
| SMILES | CCCCC(COC(=O)CCSc1ccc(I)c(SC)c1)C(C)C |
| InChI | InChI=1S/C19H29IO2S2/c1-5-6-7-15(14(2)3)13-22-19(21)10-11-24-16-8-9-17(20)18(12-16)23-4/h8-9,12,14-15H,5-7,10-11,13H2,1-4H3 |
| InChIKey | LHIYFOVXPQAWNM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|