About 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate
2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate (PubChem CID 130358082) has the molecular formula C19H29IO2S2
and a molecular weight of 480.48 g/mol. Its IUPAC name is 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate |
| PubChem CID | 130358082 |
| Molecular Formula | C19H29IO2S2 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate |
| SMILES | CCCCC(COC(=O)CCSc1ccc(I)c(SC)c1)C(C)C |
| InChI | InChI=1S/C19H29IO2S2/c1-5-6-7-15(14(2)3)13-22-19(21)10-11-24-16-8-9-17(20)18(12-16)23-4/h8-9,12,14-15H,5-7,10-11,13H2,1-4H3 |
| InChIKey | LHIYFOVXPQAWNM-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate?
The IUPAC name of 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate (CID 130358082) is 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate.
What is the SMILES notation for 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate?
The canonical SMILES for 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate is CCCCC(COC(=O)CCSc1ccc(I)c(SC)c1)C(C)C.
What is the InChIKey of 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate?
The InChIKey is LHIYFOVXPQAWNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29IO2S2/c1-5-6-7-15(14(2)3)13-22-19(21)10-11-24-16-8-9-17(20)18(12-16)23-4/h8-9,12,14-15H,5-7,10-11,13H2,1-4H3.
What are the key properties of 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate?
2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate has a molecular weight of 480.48 g/mol, XLogP of 6.50, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylhexyl 3-(4-iodo-3-methylsulfanylphenyl)sulfanylpropanoate is sourced from PubChem (CID 130358082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).