C23H32N2O2S — CID 134172886
2-ethylhexyl 3-[(2-cyano-3-hex-1-ynyl-4-pyridinyl)sulfanyl]propanoate (PubChem CID 134172886) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is 2-ethylhexyl 3-[(2-cyano-3-hex-1-ynyl-4-pyridinyl)sulfanyl]propanoate.
| Compound Name | 2-ethylhexyl 3-[(2-cyano-3-hex-1-ynyl-4-pyridinyl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 134172886 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 2-ethylhexyl 3-[(2-cyano-3-hex-1-ynyl-4-pyridinyl)sulfanyl]propanoate |
| SMILES | CCCCC#Cc1c(SCCC(=O)OCC(CC)CCCC)ccnc1C#N |
| InChI | InChI=1S/C23H32N2O2S/c1-4-7-9-10-12-20-21(17-24)25-15-13-22(20)28-16-14-23(26)27-18-19(6-3)11-8-5-2/h13,15,19H,4-9,11,14,16,18H2,1-3H3 |
| InChIKey | JYRAJPPJDVXGSN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|