About 2-ethylhexyl butanoate;2-methoxyethanol
2-ethylhexyl butanoate;2-methoxyethanol (PubChem CID 174874181) has the molecular formula C15H32O4
and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-ethylhexyl butanoate;2-methoxyethanol.
Molecular Properties
| Compound Name | 2-ethylhexyl butanoate;2-methoxyethanol |
| PubChem CID | 174874181 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2-ethylhexyl butanoate;2-methoxyethanol |
| SMILES | CCCCC(CC)COC(=O)CCC.COCCO |
| InChI | InChI=1S/C12H24O2.C3H8O2/c1-4-7-9-11(6-3)10-14-12(13)8-5-2;1-5-3-2-4/h11H,4-10H2,1-3H3;4H,2-3H2,1H3 |
| InChIKey | YYZDFRKEDYTXCQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylhexyl butanoate;2-methoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl butanoate;2-methoxyethanol?
The IUPAC name of 2-ethylhexyl butanoate;2-methoxyethanol (CID 174874181) is 2-ethylhexyl butanoate;2-methoxyethanol.
What is the SMILES notation for 2-ethylhexyl butanoate;2-methoxyethanol?
The canonical SMILES for 2-ethylhexyl butanoate;2-methoxyethanol is CCCCC(CC)COC(=O)CCC.COCCO.
What is the InChIKey of 2-ethylhexyl butanoate;2-methoxyethanol?
The InChIKey is YYZDFRKEDYTXCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O2.C3H8O2/c1-4-7-9-11(6-3)10-14-12(13)8-5-2;1-5-3-2-4/h11H,4-10H2,1-3H3;4H,2-3H2,1H3.
What are the key properties of 2-ethylhexyl butanoate;2-methoxyethanol?
2-ethylhexyl butanoate;2-methoxyethanol has a molecular weight of 276.42 g/mol, XLogP of 3.17, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl butanoate;2-methoxyethanol is sourced from PubChem (CID 174874181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).