C19H30O5 — CID 19348523
3-[2-methoxy-4-(3-methoxypropoxy)phenyl]octanoic acid (PubChem CID 19348523) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is 3-[2-methoxy-4-(3-methoxypropoxy)phenyl]octanoic acid.
| Compound Name | 3-[2-methoxy-4-(3-methoxypropoxy)phenyl]octanoic acid |
|---|---|
| PubChem CID | 19348523 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 3-[2-methoxy-4-(3-methoxypropoxy)phenyl]octanoic acid |
| SMILES | CCCCCC(CC(=O)O)c1ccc(OCCCOC)cc1OC |
| InChI | InChI=1S/C19H30O5/c1-4-5-6-8-15(13-19(20)21)17-10-9-16(14-18(17)23-3)24-12-7-11-22-2/h9-10,14-15H,4-8,11-13H2,1-3H3,(H,20,21) |
| InChIKey | SLSKXFGBDORBJH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|