C12H16F2O2 — CID 91655725
[3,4-difluoro-5-(3-methylbutoxy)phenyl]methanol (PubChem CID 91655725) has the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. Its IUPAC name is [3,4-difluoro-5-(3-methylbutoxy)phenyl]methanol.
| Compound Name | [3,4-difluoro-5-(3-methylbutoxy)phenyl]methanol |
|---|---|
| PubChem CID | 91655725 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | [3,4-difluoro-5-(3-methylbutoxy)phenyl]methanol |
| SMILES | CC(C)CCOc1cc(CO)cc(F)c1F |
| InChI | InChI=1S/C12H16F2O2/c1-8(2)3-4-16-11-6-9(7-15)5-10(13)12(11)14/h5-6,8,15H,3-4,7H2,1-2H3 |
| InChIKey | ORVLJUFKTPPYDA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |