C11H15F2NO — CID 63077921
[3,5-difluoro-4-[methyl(propan-2-yl)amino]phenyl]methanol (PubChem CID 63077921) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is [3,5-difluoro-4-[methyl(propan-2-yl)amino]phenyl]methanol.
| Compound Name | [3,5-difluoro-4-[methyl(propan-2-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 63077921 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | [3,5-difluoro-4-[methyl(propan-2-yl)amino]phenyl]methanol |
| SMILES | CC(C)N(C)c1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C11H15F2NO/c1-7(2)14(3)11-9(12)4-8(6-15)5-10(11)13/h4-5,7,15H,6H2,1-3H3 |
| InChIKey | ZWRPJVVQMMEARV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|