C16H15Cl2F2N — CID 63565693
4-(chloromethyl)-N-[1-(4-chlorophenyl)ethyl]-2,6-difluoro-N-methylaniline (PubChem CID 63565693) has the molecular formula C16H15Cl2F2N and a molecular weight of 330.21 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[1-(4-chlorophenyl)ethyl]-2,6-difluoro-N-methylaniline.
| Compound Name | 4-(chloromethyl)-N-[1-(4-chlorophenyl)ethyl]-2,6-difluoro-N-methylaniline |
|---|---|
| PubChem CID | 63565693 |
| Molecular Formula | C16H15Cl2F2N |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 4-(chloromethyl)-N-[1-(4-chlorophenyl)ethyl]-2,6-difluoro-N-methylaniline |
| SMILES | CC(c1ccc(Cl)cc1)N(C)c1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C16H15Cl2F2N/c1-10(12-3-5-13(18)6-4-12)21(2)16-14(19)7-11(9-17)8-15(16)20/h3-8,10H,9H2,1-2H3 |
| InChIKey | YNKHYWKOKNIHOU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|