C16H16ClF2NO — CID 63075837
[4-[1-(3-chlorophenyl)ethyl-methylamino]-3,5-difluorophenyl]methanol (PubChem CID 63075837) has the molecular formula C16H16ClF2NO and a molecular weight of 311.76 g/mol. Its IUPAC name is [4-[1-(3-chlorophenyl)ethyl-methylamino]-3,5-difluorophenyl]methanol.
| Compound Name | [4-[1-(3-chlorophenyl)ethyl-methylamino]-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 63075837 |
| Molecular Formula | C16H16ClF2NO |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [4-[1-(3-chlorophenyl)ethyl-methylamino]-3,5-difluorophenyl]methanol |
| SMILES | CC(c1cccc(Cl)c1)N(C)c1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C16H16ClF2NO/c1-10(12-4-3-5-13(17)8-12)20(2)16-14(18)6-11(9-21)7-15(16)19/h3-8,10,21H,9H2,1-2H3 |
| InChIKey | WRCYKUMMAZNOIO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|