C13H18ClF2N — CID 63539620
4-(chloromethyl)-2,6-difluoro-N-methyl-N-(3-methylbutan-2-yl)aniline (PubChem CID 63539620) has the molecular formula C13H18ClF2N and a molecular weight of 261.74 g/mol. Its IUPAC name is 4-(chloromethyl)-2,6-difluoro-N-methyl-N-(3-methylbutan-2-yl)aniline.
| Compound Name | 4-(chloromethyl)-2,6-difluoro-N-methyl-N-(3-methylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 63539620 |
| Molecular Formula | C13H18ClF2N |
| Molecular Weight | 261.74 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 4-(chloromethyl)-2,6-difluoro-N-methyl-N-(3-methylbutan-2-yl)aniline |
| SMILES | CC(C)C(C)N(C)c1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C13H18ClF2N/c1-8(2)9(3)17(4)13-11(15)5-10(7-14)6-12(13)16/h5-6,8-9H,7H2,1-4H3 |
| InChIKey | QARYAUWTQJCDIB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|