C12H17F2NOS — CID 112661796
[3,5-difluoro-4-[methyl(1-methylsulfanylpropan-2-yl)amino]phenyl]methanol (PubChem CID 112661796) has the molecular formula C12H17F2NOS and a molecular weight of 261.34 g/mol. Its IUPAC name is [3,5-difluoro-4-[methyl(1-methylsulfanylpropan-2-yl)amino]phenyl]methanol.
| Compound Name | [3,5-difluoro-4-[methyl(1-methylsulfanylpropan-2-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 112661796 |
| Molecular Formula | C12H17F2NOS |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | [3,5-difluoro-4-[methyl(1-methylsulfanylpropan-2-yl)amino]phenyl]methanol |
| SMILES | CSCC(C)N(C)c1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C12H17F2NOS/c1-8(7-17-3)15(2)12-10(13)4-9(6-16)5-11(12)14/h4-5,8,16H,6-7H2,1-3H3 |
| InChIKey | SZJLEEGQUASSKK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|