C15H24F2N2S — CID 115986265
4-(ethylaminomethyl)-2,6-difluoro-N-methyl-N-(1-methylsulfanylbutan-2-yl)aniline (PubChem CID 115986265) has the molecular formula C15H24F2N2S and a molecular weight of 302.43 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-2,6-difluoro-N-methyl-N-(1-methylsulfanylbutan-2-yl)aniline.
| Compound Name | 4-(ethylaminomethyl)-2,6-difluoro-N-methyl-N-(1-methylsulfanylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 115986265 |
| Molecular Formula | C15H24F2N2S |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-(ethylaminomethyl)-2,6-difluoro-N-methyl-N-(1-methylsulfanylbutan-2-yl)aniline |
| SMILES | CCNCc1cc(F)c(N(C)C(CC)CSC)c(F)c1 |
| InChI | InChI=1S/C15H24F2N2S/c1-5-12(10-20-4)19(3)15-13(16)7-11(8-14(15)17)9-18-6-2/h7-8,12,18H,5-6,9-10H2,1-4H3 |
| InChIKey | SCUOWPJUITUYLV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|