C13H18F4N2O — CID 107481434
2-[N-(2,2-difluoroethyl)-4-(ethylaminomethyl)-2,6-difluoroanilino]ethanol (PubChem CID 107481434) has the molecular formula C13H18F4N2O and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[N-(2,2-difluoroethyl)-4-(ethylaminomethyl)-2,6-difluoroanilino]ethanol.
| Compound Name | 2-[N-(2,2-difluoroethyl)-4-(ethylaminomethyl)-2,6-difluoroanilino]ethanol |
|---|---|
| PubChem CID | 107481434 |
| Molecular Formula | C13H18F4N2O |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[N-(2,2-difluoroethyl)-4-(ethylaminomethyl)-2,6-difluoroanilino]ethanol |
| SMILES | CCNCc1cc(F)c(N(CCO)CC(F)F)c(F)c1 |
| InChI | InChI=1S/C13H18F4N2O/c1-2-18-7-9-5-10(14)13(11(15)6-9)19(3-4-20)8-12(16)17/h5-6,12,18,20H,2-4,7-8H2,1H3 |
| InChIKey | DCPPOAPESUFYFL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|