C12H18FNO — CID 106529697
[3-[butan-2-yl(methyl)amino]-5-fluorophenyl]methanol (PubChem CID 106529697) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is [3-[butan-2-yl(methyl)amino]-5-fluorophenyl]methanol.
| Compound Name | [3-[butan-2-yl(methyl)amino]-5-fluorophenyl]methanol |
|---|---|
| PubChem CID | 106529697 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | [3-[butan-2-yl(methyl)amino]-5-fluorophenyl]methanol |
| SMILES | CCC(C)N(C)c1cc(F)cc(CO)c1 |
| InChI | InChI=1S/C12H18FNO/c1-4-9(2)14(3)12-6-10(8-15)5-11(13)7-12/h5-7,9,15H,4,8H2,1-3H3 |
| InChIKey | OFXFXCJLNNCCNV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |