C15H14ClF2NO — CID 63567819
4-(chloromethyl)-2,6-difluoro-N-(4-methoxyphenyl)-N-methylaniline (PubChem CID 63567819) has the molecular formula C15H14ClF2NO and a molecular weight of 297.73 g/mol. Its IUPAC name is 4-(chloromethyl)-2,6-difluoro-N-(4-methoxyphenyl)-N-methylaniline.
| Compound Name | 4-(chloromethyl)-2,6-difluoro-N-(4-methoxyphenyl)-N-methylaniline |
|---|---|
| PubChem CID | 63567819 |
| Molecular Formula | C15H14ClF2NO |
| Molecular Weight | 297.73 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-(chloromethyl)-2,6-difluoro-N-(4-methoxyphenyl)-N-methylaniline |
| SMILES | COc1ccc(N(C)c2c(F)cc(CCl)cc2F)cc1 |
| InChI | InChI=1S/C15H14ClF2NO/c1-19(11-3-5-12(20-2)6-4-11)15-13(17)7-10(9-16)8-14(15)18/h3-8H,9H2,1-2H3 |
| InChIKey | XQXDNQDEBQYFMW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|