C15H11BrF2N2 — CID 107083026
4-[4-(bromomethyl)-2,6-difluoro-N-methylanilino]benzonitrile (PubChem CID 107083026) has the molecular formula C15H11BrF2N2 and a molecular weight of 337.17 g/mol. Its IUPAC name is 4-[4-(bromomethyl)-2,6-difluoro-N-methylanilino]benzonitrile.
| Compound Name | 4-[4-(bromomethyl)-2,6-difluoro-N-methylanilino]benzonitrile |
|---|---|
| PubChem CID | 107083026 |
| Molecular Formula | C15H11BrF2N2 |
| Molecular Weight | 337.17 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-[4-(bromomethyl)-2,6-difluoro-N-methylanilino]benzonitrile |
| SMILES | CN(c1ccc(C#N)cc1)c1c(F)cc(CBr)cc1F |
| InChI | InChI=1S/C15H11BrF2N2/c1-20(12-4-2-10(9-19)3-5-12)15-13(17)6-11(8-16)7-14(15)18/h2-7H,8H2,1H3 |
| InChIKey | KZWGAMYGCVKRGX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.17 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|