C17H15BrFNO — CID 43324535
4-[[4-(bromomethyl)-2,6-dimethylphenoxy]methyl]-3-fluorobenzonitrile (PubChem CID 43324535) has the molecular formula C17H15BrFNO and a molecular weight of 348.22 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)-2,6-dimethylphenoxy]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[4-(bromomethyl)-2,6-dimethylphenoxy]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 43324535 |
| Molecular Formula | C17H15BrFNO |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-[[4-(bromomethyl)-2,6-dimethylphenoxy]methyl]-3-fluorobenzonitrile |
| SMILES | Cc1cc(CBr)cc(C)c1OCc1ccc(C#N)cc1F |
| InChI | InChI=1S/C17H15BrFNO/c1-11-5-14(8-18)6-12(2)17(11)21-10-15-4-3-13(9-20)7-16(15)19/h3-7H,8,10H2,1-2H3 |
| InChIKey | SSYSCXKJXZECPP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|