C15H9BrClF2NO — CID 102668791
4-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-3-chlorobenzonitrile (PubChem CID 102668791) has the molecular formula C15H9BrClF2NO and a molecular weight of 372.60 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-3-chlorobenzonitrile.
| Compound Name | 4-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-3-chlorobenzonitrile |
|---|---|
| PubChem CID | 102668791 |
| Molecular Formula | C15H9BrClF2NO |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | 4-[[4-(bromomethyl)-2,6-difluorophenoxy]methyl]-3-chlorobenzonitrile |
| SMILES | N#Cc1ccc(COc2c(F)cc(CBr)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C15H9BrClF2NO/c16-6-10-4-13(18)15(14(19)5-10)21-8-11-2-1-9(7-20)3-12(11)17/h1-5H,6,8H2 |
| InChIKey | RAERDWOPSSTIDW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|