C13H19F2NO2 — CID 55226530
[4-[2-ethoxyethyl(ethyl)amino]-3,5-difluorophenyl]methanol (PubChem CID 55226530) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is [4-[2-ethoxyethyl(ethyl)amino]-3,5-difluorophenyl]methanol.
| Compound Name | [4-[2-ethoxyethyl(ethyl)amino]-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 55226530 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | [4-[2-ethoxyethyl(ethyl)amino]-3,5-difluorophenyl]methanol |
| SMILES | CCOCCN(CC)c1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C13H19F2NO2/c1-3-16(5-6-18-4-2)13-11(14)7-10(9-17)8-12(13)15/h7-8,17H,3-6,9H2,1-2H3 |
| InChIKey | XLDCJXMWJGHGKV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|