C15H22BrF2NO2 — CID 107084914
4-(bromomethyl)-N,N-bis(2-ethoxyethyl)-2,6-difluoroaniline (PubChem CID 107084914) has the molecular formula C15H22BrF2NO2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 4-(bromomethyl)-N,N-bis(2-ethoxyethyl)-2,6-difluoroaniline.
| Compound Name | 4-(bromomethyl)-N,N-bis(2-ethoxyethyl)-2,6-difluoroaniline |
|---|---|
| PubChem CID | 107084914 |
| Molecular Formula | C15H22BrF2NO2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | 4-(bromomethyl)-N,N-bis(2-ethoxyethyl)-2,6-difluoroaniline |
| SMILES | CCOCCN(CCOCC)c1c(F)cc(CBr)cc1F |
| InChI | InChI=1S/C15H22BrF2NO2/c1-3-20-7-5-19(6-8-21-4-2)15-13(17)9-12(11-16)10-14(15)18/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | IYHDRHAOKBBXJW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|