C13H20F2N2O — CID 63691026
4-(aminomethyl)-N-(2-ethoxyethyl)-N-ethyl-2,6-difluoroaniline (PubChem CID 63691026) has the molecular formula C13H20F2N2O and a molecular weight of 258.31 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2-ethoxyethyl)-N-ethyl-2,6-difluoroaniline.
| Compound Name | 4-(aminomethyl)-N-(2-ethoxyethyl)-N-ethyl-2,6-difluoroaniline |
|---|---|
| PubChem CID | 63691026 |
| Molecular Formula | C13H20F2N2O |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 4-(aminomethyl)-N-(2-ethoxyethyl)-N-ethyl-2,6-difluoroaniline |
| SMILES | CCOCCN(CC)c1c(F)cc(CN)cc1F |
| InChI | InChI=1S/C13H20F2N2O/c1-3-17(5-6-18-4-2)13-11(14)7-10(9-16)8-12(13)15/h7-8H,3-6,9,16H2,1-2H3 |
| InChIKey | QKNJOEDLJBLAHT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|