C13H18ClF2NO — CID 63698104
4-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-2,6-difluoroaniline (PubChem CID 63698104) has the molecular formula C13H18ClF2NO and a molecular weight of 277.74 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-2,6-difluoroaniline.
| Compound Name | 4-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-2,6-difluoroaniline |
|---|---|
| PubChem CID | 63698104 |
| Molecular Formula | C13H18ClF2NO |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-(chloromethyl)-N-(2-ethoxyethyl)-N-ethyl-2,6-difluoroaniline |
| SMILES | CCOCCN(CC)c1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C13H18ClF2NO/c1-3-17(5-6-18-4-2)13-11(15)7-10(9-14)8-12(13)16/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | GEZPFLHHYVSXBD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|