C12H16BrF2NO — CID 107081493
4-(bromomethyl)-N-ethyl-2,6-difluoro-N-(2-methoxyethyl)aniline (PubChem CID 107081493) has the molecular formula C12H16BrF2NO and a molecular weight of 308.17 g/mol. Its IUPAC name is 4-(bromomethyl)-N-ethyl-2,6-difluoro-N-(2-methoxyethyl)aniline.
| Compound Name | 4-(bromomethyl)-N-ethyl-2,6-difluoro-N-(2-methoxyethyl)aniline |
|---|---|
| PubChem CID | 107081493 |
| Molecular Formula | C12H16BrF2NO |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 4-(bromomethyl)-N-ethyl-2,6-difluoro-N-(2-methoxyethyl)aniline |
| SMILES | CCN(CCOC)c1c(F)cc(CBr)cc1F |
| InChI | InChI=1S/C12H16BrF2NO/c1-3-16(4-5-17-2)12-10(14)6-9(8-13)7-11(12)15/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | RPUMQUMABMGQTD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|