C11H13F2NO — CID 63052056
3,5-difluoro-4-[methyl(propan-2-yl)amino]benzaldehyde (PubChem CID 63052056) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 3,5-difluoro-4-[methyl(propan-2-yl)amino]benzaldehyde.
| Compound Name | 3,5-difluoro-4-[methyl(propan-2-yl)amino]benzaldehyde |
|---|---|
| PubChem CID | 63052056 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3,5-difluoro-4-[methyl(propan-2-yl)amino]benzaldehyde |
| SMILES | CC(C)N(C)c1c(F)cc(C=O)cc1F |
| InChI | InChI=1S/C11H13F2NO/c1-7(2)14(3)11-9(12)4-8(6-15)5-10(11)13/h4-7H,1-3H3 |
| InChIKey | GFWODVIBNXVAGG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|