C8H6F2O3S — CID 11499527
3,5-difluoro-4-methylsulfonylbenzaldehyde (PubChem CID 11499527) has the molecular formula C8H6F2O3S and a molecular weight of 220.20 g/mol. Its IUPAC name is 3,5-difluoro-4-methylsulfonylbenzaldehyde.
| Compound Name | 3,5-difluoro-4-methylsulfonylbenzaldehyde |
|---|---|
| PubChem CID | 11499527 |
| Molecular Formula | C8H6F2O3S |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.00 |
| IUPAC Name | 3,5-difluoro-4-methylsulfonylbenzaldehyde |
| SMILES | CS(=O)(=O)c1c(F)cc(C=O)cc1F |
| InChI | InChI=1S/C8H6F2O3S/c1-14(12,13)8-6(9)2-5(4-11)3-7(8)10/h2-4H,1H3 |
| InChIKey | UTVZEIJFGZPQEA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|