C13H10F2O2S — CID 123960607
1,3-difluoro-2-methylsulfonyl-5-phenylbenzene (PubChem CID 123960607) has the molecular formula C13H10F2O2S and a molecular weight of 268.28 g/mol. Its IUPAC name is 1,3-difluoro-2-methylsulfonyl-5-phenylbenzene.
| Compound Name | 1,3-difluoro-2-methylsulfonyl-5-phenylbenzene |
|---|---|
| PubChem CID | 123960607 |
| Molecular Formula | C13H10F2O2S |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 1,3-difluoro-2-methylsulfonyl-5-phenylbenzene |
| SMILES | CS(=O)(=O)c1c(F)cc(-c2ccccc2)cc1F |
| InChI | InChI=1S/C13H10F2O2S/c1-18(16,17)13-11(14)7-10(8-12(13)15)9-5-3-2-4-6-9/h2-8H,1H3 |
| InChIKey | XIUATJGRZSSZMM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |