About 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine
3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine (PubChem CID 22745487) has the molecular formula C17H13F2NO2S
and a molecular weight of 333.36 g/mol. Its IUPAC name is 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine.
Molecular Properties
| Compound Name | 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine |
| PubChem CID | 22745487 |
| Molecular Formula | C17H13F2NO2S |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine |
| SMILES | CS(=O)(=O)c1c(F)cc(C2=CCC=C2c2cccnc2)cc1F |
| InChI | InChI=1S/C17H13F2NO2S/c1-23(21,22)17-15(18)8-12(9-16(17)19)14-6-2-5-13(14)11-4-3-7-20-10-11/h3-10H,2H2,1H3 |
| InChIKey | NLUWLUUCYMJDLX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine?
The IUPAC name of 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine (CID 22745487) is 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine.
What is the SMILES notation for 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine?
The canonical SMILES for 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine is CS(=O)(=O)c1c(F)cc(C2=CCC=C2c2cccnc2)cc1F.
What is the InChIKey of 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine?
The InChIKey is NLUWLUUCYMJDLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2NO2S/c1-23(21,22)17-15(18)8-12(9-16(17)19)14-6-2-5-13(14)11-4-3-7-20-10-11/h3-10H,2H2,1H3.
What are the key properties of 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine?
3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine has a molecular weight of 333.36 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3,5-difluoro-4-methylsulfonylphenyl)cyclopenta-1,4-dien-1-yl]pyridine is sourced from PubChem (CID 22745487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).