C17H17F2NO2S — CID 22745664
4-cyclopentyl-3-(3,5-difluoro-4-methylsulfonylphenyl)pyridine (PubChem CID 22745664) has the molecular formula C17H17F2NO2S and a molecular weight of 337.39 g/mol. Its IUPAC name is 4-cyclopentyl-3-(3,5-difluoro-4-methylsulfonylphenyl)pyridine.
| Compound Name | 4-cyclopentyl-3-(3,5-difluoro-4-methylsulfonylphenyl)pyridine |
|---|---|
| PubChem CID | 22745664 |
| Molecular Formula | C17H17F2NO2S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-cyclopentyl-3-(3,5-difluoro-4-methylsulfonylphenyl)pyridine |
| SMILES | CS(=O)(=O)c1c(F)cc(-c2cnccc2C2CCCC2)cc1F |
| InChI | InChI=1S/C17H17F2NO2S/c1-23(21,22)17-15(18)8-12(9-16(17)19)14-10-20-7-6-13(14)11-4-2-3-5-11/h6-11H,2-5H2,1H3 |
| InChIKey | DFRIHKAIPBGDSN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |