C20H18FNO2S — CID 70122138
4-(3,5-dimethylphenyl)-3-(3-fluoro-4-methylsulfonylphenyl)pyridine (PubChem CID 70122138) has the molecular formula C20H18FNO2S and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-3-(3-fluoro-4-methylsulfonylphenyl)pyridine.
| Compound Name | 4-(3,5-dimethylphenyl)-3-(3-fluoro-4-methylsulfonylphenyl)pyridine |
|---|---|
| PubChem CID | 70122138 |
| Molecular Formula | C20H18FNO2S |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-3-(3-fluoro-4-methylsulfonylphenyl)pyridine |
| SMILES | Cc1cc(C)cc(-c2ccncc2-c2ccc(S(C)(=O)=O)c(F)c2)c1 |
| InChI | InChI=1S/C20H18FNO2S/c1-13-8-14(2)10-16(9-13)17-6-7-22-12-18(17)15-4-5-20(19(21)11-15)25(3,23)24/h4-12H,1-3H3 |
| InChIKey | QGCNZJMIFJNLGY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |