C18H12F3NO2S — CID 22745781
3-(2,5-difluoro-4-methylsulfonylphenyl)-4-(4-fluorophenyl)pyridine (PubChem CID 22745781) has the molecular formula C18H12F3NO2S and a molecular weight of 363.36 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-methylsulfonylphenyl)-4-(4-fluorophenyl)pyridine.
| Compound Name | 3-(2,5-difluoro-4-methylsulfonylphenyl)-4-(4-fluorophenyl)pyridine |
|---|---|
| PubChem CID | 22745781 |
| Molecular Formula | C18H12F3NO2S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-(2,5-difluoro-4-methylsulfonylphenyl)-4-(4-fluorophenyl)pyridine |
| SMILES | CS(=O)(=O)c1cc(F)c(-c2cnccc2-c2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C18H12F3NO2S/c1-25(23,24)18-9-16(20)14(8-17(18)21)15-10-22-7-6-13(15)11-2-4-12(19)5-3-11/h2-10H,1H3 |
| InChIKey | UXVQZCUKIQLVOZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |