C8H5F3O3S — CID 117275451
2,3,5-trifluoro-4-methylsulfonylbenzaldehyde (PubChem CID 117275451) has the molecular formula C8H5F3O3S and a molecular weight of 238.19 g/mol. Its IUPAC name is 2,3,5-trifluoro-4-methylsulfonylbenzaldehyde.
| Compound Name | 2,3,5-trifluoro-4-methylsulfonylbenzaldehyde |
|---|---|
| PubChem CID | 117275451 |
| Molecular Formula | C8H5F3O3S |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | 2,3,5-trifluoro-4-methylsulfonylbenzaldehyde |
| SMILES | CS(=O)(=O)c1c(F)cc(C=O)c(F)c1F |
| InChI | InChI=1S/C8H5F3O3S/c1-15(13,14)8-5(9)2-4(3-12)6(10)7(8)11/h2-3H,1H3 |
| InChIKey | XVTGGMWHYXGIOD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|