C12H13F3O4S — CID 117495261
2,2-dimethyl-3-(2,3,5-trifluoro-4-methylsulfonylphenyl)propanoic acid (PubChem CID 117495261) has the molecular formula C12H13F3O4S and a molecular weight of 310.29 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,3,5-trifluoro-4-methylsulfonylphenyl)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(2,3,5-trifluoro-4-methylsulfonylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117495261 |
| Molecular Formula | C12H13F3O4S |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2,2-dimethyl-3-(2,3,5-trifluoro-4-methylsulfonylphenyl)propanoic acid |
| SMILES | CC(C)(Cc1cc(F)c(S(C)(=O)=O)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C12H13F3O4S/c1-12(2,11(16)17)5-6-4-7(13)10(20(3,18)19)9(15)8(6)14/h4H,5H2,1-3H3,(H,16,17) |
| InChIKey | QTORKFSDMODLOG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|