C11H12F2O5S — CID 117474669
4-(3,5-difluoro-2-hydroxy-4-methylsulfonylphenyl)butanoic acid (PubChem CID 117474669) has the molecular formula C11H12F2O5S and a molecular weight of 294.27 g/mol. Its IUPAC name is 4-(3,5-difluoro-2-hydroxy-4-methylsulfonylphenyl)butanoic acid.
| Compound Name | 4-(3,5-difluoro-2-hydroxy-4-methylsulfonylphenyl)butanoic acid |
|---|---|
| PubChem CID | 117474669 |
| Molecular Formula | C11H12F2O5S |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 4-(3,5-difluoro-2-hydroxy-4-methylsulfonylphenyl)butanoic acid |
| SMILES | CS(=O)(=O)c1c(F)cc(CCCC(=O)O)c(O)c1F |
| InChI | InChI=1S/C11H12F2O5S/c1-19(17,18)11-7(12)5-6(10(16)9(11)13)3-2-4-8(14)15/h5,16H,2-4H2,1H3,(H,14,15) |
| InChIKey | NEHZSVBBQKLMRP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |